C11H10F2OS — CID 169456758
S-[3-(2,3-difluorophenyl)prop-2-enyl] ethanethioate (PubChem CID 169456758) has the molecular formula C11H10F2OS and a molecular weight of 228.26 g/mol. Its IUPAC name is S-[3-(2,3-difluorophenyl)prop-2-enyl] ethanethioate.
| Compound Name | S-[3-(2,3-difluorophenyl)prop-2-enyl] ethanethioate |
|---|---|
| PubChem CID | 169456758 |
| Molecular Formula | C11H10F2OS |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | S-[3-(2,3-difluorophenyl)prop-2-enyl] ethanethioate |
| SMILES | CC(=O)SCC=Cc1cccc(F)c1F |
| InChI | InChI=1S/C11H10F2OS/c1-8(14)15-7-3-5-9-4-2-6-10(12)11(9)13/h2-6H,7H2,1H3 |
| InChIKey | HQSSYSZVXGKQQW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|