C12H10F2O3S — CID 169457760
3-(3-acetylsulfanylprop-1-enyl)-2,6-difluorobenzoic acid (PubChem CID 169457760) has the molecular formula C12H10F2O3S and a molecular weight of 272.27 g/mol. Its IUPAC name is 3-(3-acetylsulfanylprop-1-enyl)-2,6-difluorobenzoic acid.
| Compound Name | 3-(3-acetylsulfanylprop-1-enyl)-2,6-difluorobenzoic acid |
|---|---|
| PubChem CID | 169457760 |
| Molecular Formula | C12H10F2O3S |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 3-(3-acetylsulfanylprop-1-enyl)-2,6-difluorobenzoic acid |
| SMILES | CC(=O)SCC=Cc1ccc(F)c(C(=O)O)c1F |
| InChI | InChI=1S/C12H10F2O3S/c1-7(15)18-6-2-3-8-4-5-9(13)10(11(8)14)12(16)17/h2-5H,6H2,1H3,(H,16,17) |
| InChIKey | MMRBZGFRPWOGDH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|