C13H12F4OS — CID 170480609
S-[4-[4-fluoro-3-(trifluoromethyl)phenyl]but-3-enyl] ethanethioate (PubChem CID 170480609) has the molecular formula C13H12F4OS and a molecular weight of 292.30 g/mol. Its IUPAC name is S-[4-[4-fluoro-3-(trifluoromethyl)phenyl]but-3-enyl] ethanethioate.
| Compound Name | S-[4-[4-fluoro-3-(trifluoromethyl)phenyl]but-3-enyl] ethanethioate |
|---|---|
| PubChem CID | 170480609 |
| Molecular Formula | C13H12F4OS |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | S-[4-[4-fluoro-3-(trifluoromethyl)phenyl]but-3-enyl] ethanethioate |
| SMILES | CC(=O)SCCC=Cc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H12F4OS/c1-9(18)19-7-3-2-4-10-5-6-12(14)11(8-10)13(15,16)17/h2,4-6,8H,3,7H2,1H3 |
| InChIKey | YRYGAXOUQZGBBW-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|