C14H15FO3S — CID 170480631
2-[4-(4-acetylsulfanylbut-1-enyl)-2-fluorophenyl]acetic acid (PubChem CID 170480631) has the molecular formula C14H15FO3S and a molecular weight of 282.34 g/mol. Its IUPAC name is 2-[4-(4-acetylsulfanylbut-1-enyl)-2-fluorophenyl]acetic acid.
| Compound Name | 2-[4-(4-acetylsulfanylbut-1-enyl)-2-fluorophenyl]acetic acid |
|---|---|
| PubChem CID | 170480631 |
| Molecular Formula | C14H15FO3S |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 2-[4-(4-acetylsulfanylbut-1-enyl)-2-fluorophenyl]acetic acid |
| SMILES | CC(=O)SCCC=Cc1ccc(CC(=O)O)c(F)c1 |
| InChI | InChI=1S/C14H15FO3S/c1-10(16)19-7-3-2-4-11-5-6-12(9-14(17)18)13(15)8-11/h2,4-6,8H,3,7,9H2,1H3,(H,17,18) |
| InChIKey | NMLFLVPORDEDLK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|