C13H15NO2S — CID 170480216
S-[4-(4-carbamoylphenyl)but-3-enyl] ethanethioate (PubChem CID 170480216) has the molecular formula C13H15NO2S and a molecular weight of 249.34 g/mol. Its IUPAC name is S-[4-(4-carbamoylphenyl)but-3-enyl] ethanethioate.
| Compound Name | S-[4-(4-carbamoylphenyl)but-3-enyl] ethanethioate |
|---|---|
| PubChem CID | 170480216 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | S-[4-(4-carbamoylphenyl)but-3-enyl] ethanethioate |
| SMILES | CC(=O)SCCC=Cc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C13H15NO2S/c1-10(15)17-9-3-2-4-11-5-7-12(8-6-11)13(14)16/h2,4-8H,3,9H2,1H3,(H2,14,16) |
| InChIKey | BWANIGKGAFQPCQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|