C16H15F3O3S — CID 170481118
S-[4-[4-(4,4,4-trifluoro-3-oxobutanoyl)phenyl]but-3-enyl] ethanethioate (PubChem CID 170481118) has the molecular formula C16H15F3O3S and a molecular weight of 344.35 g/mol. Its IUPAC name is S-[4-[4-(4,4,4-trifluoro-3-oxobutanoyl)phenyl]but-3-enyl] ethanethioate.
| Compound Name | S-[4-[4-(4,4,4-trifluoro-3-oxobutanoyl)phenyl]but-3-enyl] ethanethioate |
|---|---|
| PubChem CID | 170481118 |
| Molecular Formula | C16H15F3O3S |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | S-[4-[4-(4,4,4-trifluoro-3-oxobutanoyl)phenyl]but-3-enyl] ethanethioate |
| SMILES | CC(=O)SCCC=Cc1ccc(C(=O)CC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H15F3O3S/c1-11(20)23-9-3-2-4-12-5-7-13(8-6-12)14(21)10-15(22)16(17,18)19/h2,4-8H,3,9-10H2,1H3 |
| InChIKey | JJBVGUQXMHYVGP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|