C14H16O4S — CID 170480704
2-[4-(4-acetylsulfanylbut-1-enyl)phenoxy]acetic acid (PubChem CID 170480704) has the molecular formula C14H16O4S and a molecular weight of 280.35 g/mol. Its IUPAC name is 2-[4-(4-acetylsulfanylbut-1-enyl)phenoxy]acetic acid.
| Compound Name | 2-[4-(4-acetylsulfanylbut-1-enyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 170480704 |
| Molecular Formula | C14H16O4S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 2-[4-(4-acetylsulfanylbut-1-enyl)phenoxy]acetic acid |
| SMILES | CC(=O)SCCC=Cc1ccc(OCC(=O)O)cc1 |
| InChI | InChI=1S/C14H16O4S/c1-11(15)19-9-3-2-4-12-5-7-13(8-6-12)18-10-14(16)17/h2,4-8H,3,9-10H2,1H3,(H,16,17) |
| InChIKey | SUMYKRDJOQDDJE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|