C13H9F3O3 — CID 169459942
3-[4-(4,4,4-trifluoro-3-oxobutanoyl)phenyl]prop-2-enal (PubChem CID 169459942) has the molecular formula C13H9F3O3 and a molecular weight of 270.21 g/mol. Its IUPAC name is 3-[4-(4,4,4-trifluoro-3-oxobutanoyl)phenyl]prop-2-enal.
| Compound Name | 3-[4-(4,4,4-trifluoro-3-oxobutanoyl)phenyl]prop-2-enal |
|---|---|
| PubChem CID | 169459942 |
| Molecular Formula | C13H9F3O3 |
| Molecular Weight | 270.21 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 3-[4-(4,4,4-trifluoro-3-oxobutanoyl)phenyl]prop-2-enal |
| SMILES | O=CC=Cc1ccc(C(=O)CC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H9F3O3/c14-13(15,16)12(19)8-11(18)10-5-3-9(4-6-10)2-1-7-17/h1-7H,8H2 |
| InChIKey | BEKSTAUTBGEOAN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.21 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|