C13H9F3O3 — CID 169485801
4,4,4-trifluoro-1-[4-(3-hydroxyprop-1-ynyl)phenyl]butane-1,3-dione (PubChem CID 169485801) has the molecular formula C13H9F3O3 and a molecular weight of 270.21 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-[4-(3-hydroxyprop-1-ynyl)phenyl]butane-1,3-dione.
| Compound Name | 4,4,4-trifluoro-1-[4-(3-hydroxyprop-1-ynyl)phenyl]butane-1,3-dione |
|---|---|
| PubChem CID | 169485801 |
| Molecular Formula | C13H9F3O3 |
| Molecular Weight | 270.21 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 4,4,4-trifluoro-1-[4-(3-hydroxyprop-1-ynyl)phenyl]butane-1,3-dione |
| SMILES | O=C(CC(=O)C(F)(F)F)c1ccc(C#CCO)cc1 |
| InChI | InChI=1S/C13H9F3O3/c14-13(15,16)12(19)8-11(18)10-5-3-9(4-6-10)2-1-7-17/h3-6,17H,7-8H2 |
| InChIKey | WACHOGDCXNZZEU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.21 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|