C13H14N2O4S — CID 170480993
S-[4-(3-carbamoyl-5-nitrophenyl)but-3-enyl] ethanethioate (PubChem CID 170480993) has the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. Its IUPAC name is S-[4-(3-carbamoyl-5-nitrophenyl)but-3-enyl] ethanethioate.
| Compound Name | S-[4-(3-carbamoyl-5-nitrophenyl)but-3-enyl] ethanethioate |
|---|---|
| PubChem CID | 170480993 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | S-[4-(3-carbamoyl-5-nitrophenyl)but-3-enyl] ethanethioate |
| SMILES | CC(=O)SCCC=Cc1cc(C(N)=O)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H14N2O4S/c1-9(16)20-5-3-2-4-10-6-11(13(14)17)8-12(7-10)15(18)19/h2,4,6-8H,3,5H2,1H3,(H2,14,17) |
| InChIKey | FLBFPQJTFIFHQI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|