C7H6ClN3O5 — CID 172864761
3,5-dinitrobenzamide;hydrochloride (PubChem CID 172864761) has the molecular formula C7H6ClN3O5 and a molecular weight of 247.59 g/mol. Its IUPAC name is 3,5-dinitrobenzamide;hydrochloride.
| Compound Name | 3,5-dinitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 172864761 |
| Molecular Formula | C7H6ClN3O5 |
| Molecular Weight | 247.59 g/mol |
| Exact Mass | 247.00 |
| IUPAC Name | 3,5-dinitrobenzamide;hydrochloride |
| SMILES | Cl.NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H5N3O5.ClH/c8-7(11)4-1-5(9(12)13)3-6(2-4)10(14)15;/h1-3H,(H2,8,11);1H |
| InChIKey | ZVKYGJSJVAUKAG-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 129.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.59 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|