C16H27N3O8Si — CID 158915248
3,5-dinitrobenzamide;triethoxy(propyl)silane (PubChem CID 158915248) has the molecular formula C16H27N3O8Si and a molecular weight of 417.49 g/mol. Its IUPAC name is 3,5-dinitrobenzamide;triethoxy(propyl)silane.
| Compound Name | 3,5-dinitrobenzamide;triethoxy(propyl)silane |
|---|---|
| PubChem CID | 158915248 |
| Molecular Formula | C16H27N3O8Si |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 3,5-dinitrobenzamide;triethoxy(propyl)silane |
| SMILES | CCC[Si](OCC)(OCC)OCC.NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H22O3Si.C7H5N3O5/c1-5-9-13(10-6-2,11-7-3)12-8-4;8-7(11)4-1-5(9(12)13)3-6(2-4)10(14)15/h5-9H2,1-4H3;1-3H,(H2,8,11) |
| InChIKey | JHDMNJMPGIZCCR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 157.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|