C16H25N3O8Si — CID 87259604
3,5-dinitro-N-propyl-N-triethoxysilylbenzamide (PubChem CID 87259604) has the molecular formula C16H25N3O8Si and a molecular weight of 415.48 g/mol. Its IUPAC name is 3,5-dinitro-N-propyl-N-triethoxysilylbenzamide.
| Compound Name | 3,5-dinitro-N-propyl-N-triethoxysilylbenzamide |
|---|---|
| PubChem CID | 87259604 |
| Molecular Formula | C16H25N3O8Si |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 3,5-dinitro-N-propyl-N-triethoxysilylbenzamide |
| SMILES | CCCN(C(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C16H25N3O8Si/c1-5-9-17(28(25-6-2,26-7-3)27-8-4)16(20)13-10-14(18(21)22)12-15(11-13)19(23)24/h10-12H,5-9H2,1-4H3 |
| InChIKey | ZFJKNCDDXQHYIO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 134.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|