C21H35N3O6 — CID 161304208
N,N-dimethyldodecan-1-amine;3,5-dinitrobenzoic acid (PubChem CID 161304208) has the molecular formula C21H35N3O6 and a molecular weight of 425.53 g/mol. Its IUPAC name is N,N-dimethyldodecan-1-amine;3,5-dinitrobenzoic acid.
| Compound Name | N,N-dimethyldodecan-1-amine;3,5-dinitrobenzoic acid |
|---|---|
| PubChem CID | 161304208 |
| Molecular Formula | C21H35N3O6 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | N,N-dimethyldodecan-1-amine;3,5-dinitrobenzoic acid |
| SMILES | CCCCCCCCCCCCN(C)C.O=C(O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H31N.C7H4N2O6/c1-4-5-6-7-8-9-10-11-12-13-14-15(2)3;10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h4-14H2,1-3H3;1-3H,(H,10,11) |
| InChIKey | VIAIWZKEDSVBNN-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|