About 3-nitrobenzoic acid;non-1-ene
3-nitrobenzoic acid;non-1-ene (PubChem CID 67066663) has the molecular formula C16H23NO4
and a molecular weight of 293.36 g/mol. Its IUPAC name is 3-nitrobenzoic acid;non-1-ene.
Molecular Properties
| Compound Name | 3-nitrobenzoic acid;non-1-ene |
| PubChem CID | 67066663 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 3-nitrobenzoic acid;non-1-ene |
| SMILES | C=CCCCCCCC.O=C(O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H18.C7H5NO4/c1-3-5-7-9-8-6-4-2;9-7(10)5-2-1-3-6(4-5)8(11)12/h3H,1,4-9H2,2H3;1-4H,(H,9,10) |
| InChIKey | BDTLIHVPXZZLKM-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitrobenzoic acid;non-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitrobenzoic acid;non-1-ene?
The IUPAC name of 3-nitrobenzoic acid;non-1-ene (CID 67066663) is 3-nitrobenzoic acid;non-1-ene.
What is the SMILES notation for 3-nitrobenzoic acid;non-1-ene?
The canonical SMILES for 3-nitrobenzoic acid;non-1-ene is C=CCCCCCCC.O=C(O)c1cccc([N+](=O)[O-])c1.
What is the InChIKey of 3-nitrobenzoic acid;non-1-ene?
The InChIKey is BDTLIHVPXZZLKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18.C7H5NO4/c1-3-5-7-9-8-6-4-2;9-7(10)5-2-1-3-6(4-5)8(11)12/h3H,1,4-9H2,2H3;1-4H,(H,9,10).
What are the key properties of 3-nitrobenzoic acid;non-1-ene?
3-nitrobenzoic acid;non-1-ene has a molecular weight of 293.36 g/mol, XLogP of 4.83, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitrobenzoic acid;non-1-ene is sourced from PubChem (CID 67066663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).