C18H26N2O8 — CID 174268515
butane;1,3-dinitrobenzene;bis(2-methylprop-2-enoic acid) (PubChem CID 174268515) has the molecular formula C18H26N2O8 and a molecular weight of 398.41 g/mol. Its IUPAC name is butane;1,3-dinitrobenzene;bis(2-methylprop-2-enoic acid).
| Compound Name | butane;1,3-dinitrobenzene;bis(2-methylprop-2-enoic acid) |
|---|---|
| PubChem CID | 174268515 |
| Molecular Formula | C18H26N2O8 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | butane;1,3-dinitrobenzene;bis(2-methylprop-2-enoic acid) |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)O.CCCC.O=[N+]([O-])c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H4N2O4.2C4H6O2.C4H10/c9-7(10)5-2-1-3-6(4-5)8(11)12;2*1-3(2)4(5)6;1-3-4-2/h1-4H;2*1H2,2H3,(H,5,6);3-4H2,1-2H3 |
| InChIKey | NNAWEXOSKRETSK-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 160.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|