C28H36N2O4 — CID 11648366
1-nitro-3-[(4Z,6Z)-7-(3-nitrophenyl)-5,6-dipropyldeca-4,6-dien-4-yl]benzene (PubChem CID 11648366) has the molecular formula C28H36N2O4 and a molecular weight of 464.61 g/mol. Its IUPAC name is 1-nitro-3-[(4Z,6Z)-7-(3-nitrophenyl)-5,6-dipropyldeca-4,6-dien-4-yl]benzene.
| Compound Name | 1-nitro-3-[(4Z,6Z)-7-(3-nitrophenyl)-5,6-dipropyldeca-4,6-dien-4-yl]benzene |
|---|---|
| PubChem CID | 11648366 |
| Molecular Formula | C28H36N2O4 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | 1-nitro-3-[(4Z,6Z)-7-(3-nitrophenyl)-5,6-dipropyldeca-4,6-dien-4-yl]benzene |
| SMILES | CCCC(/C(CCC)=C(/CCC)c1cccc([N+](=O)[O-])c1)=C(\CCC)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H36N2O4/c1-5-11-25(21-15-9-17-23(19-21)29(31)32)27(13-7-3)28(14-8-4)26(12-6-2)22-16-10-18-24(20-22)30(33)34/h9-10,15-20H,5-8,11-14H2,1-4H3/b27-25-,28-26- |
| InChIKey | LSGNOMAEVCOCIQ-LBXGSASVSA-N |
| XLogP | 8.91 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|