C20H24N4O5 — CID 172928678
1-(3-nitrophenyl)butan-1-one;(E)-1-(3-nitrophenyl)butylidenehydrazine (PubChem CID 172928678) has the molecular formula C20H24N4O5 and a molecular weight of 400.44 g/mol. Its IUPAC name is 1-(3-nitrophenyl)butan-1-one;(E)-1-(3-nitrophenyl)butylidenehydrazine.
| Compound Name | 1-(3-nitrophenyl)butan-1-one;(E)-1-(3-nitrophenyl)butylidenehydrazine |
|---|---|
| PubChem CID | 172928678 |
| Molecular Formula | C20H24N4O5 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 1-(3-nitrophenyl)butan-1-one;(E)-1-(3-nitrophenyl)butylidenehydrazine |
| SMILES | CCC/C(=N\N)c1cccc([N+](=O)[O-])c1.CCCC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H13N3O2.C10H11NO3/c1-2-4-10(12-11)8-5-3-6-9(7-8)13(14)15;1-2-4-10(12)8-5-3-6-9(7-8)11(13)14/h3,5-7H,2,4,11H2,1H3;3,5-7H,2,4H2,1H3/b12-10+; |
| InChIKey | BIQMHIOUQLFGOS-VHPXAQPISA-N |
| XLogP | 4.64 |
| TPSA | 141.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|