C24H28N6O6 — CID 3943265
N,N'-bis[1-(3-nitrophenyl)propylideneamino]hexanediamide (PubChem CID 3943265) has the molecular formula C24H28N6O6 and a molecular weight of 496.52 g/mol. Its IUPAC name is N,N'-bis[1-(3-nitrophenyl)propylideneamino]hexanediamide.
| Compound Name | N,N'-bis[1-(3-nitrophenyl)propylideneamino]hexanediamide |
|---|---|
| PubChem CID | 3943265 |
| Molecular Formula | C24H28N6O6 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | N,N'-bis[1-(3-nitrophenyl)propylideneamino]hexanediamide |
| SMILES | CCC(=NNC(=O)CCCCC(=O)NN=C(CC)c1cccc([N+](=O)[O-])c1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H28N6O6/c1-3-21(17-9-7-11-19(15-17)29(33)34)25-27-23(31)13-5-6-14-24(32)28-26-22(4-2)18-10-8-12-20(16-18)30(35)36/h7-12,15-16H,3-6,13-14H2,1-2H3,(H,27,31)(H,28,32) |
| InChIKey | UQFKDFMHSCQYGQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 169.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|