C11H14N4O3 — CID 9017207
[(Z)-1-(3-nitrophenyl)butylideneamino]urea (PubChem CID 9017207) has the molecular formula C11H14N4O3 and a molecular weight of 250.26 g/mol. Its IUPAC name is [(Z)-1-(3-nitrophenyl)butylideneamino]urea.
| Compound Name | [(Z)-1-(3-nitrophenyl)butylideneamino]urea |
|---|---|
| PubChem CID | 9017207 |
| Molecular Formula | C11H14N4O3 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | [(Z)-1-(3-nitrophenyl)butylideneamino]urea |
| SMILES | CCC/C(=N/NC(N)=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H14N4O3/c1-2-4-10(13-14-11(12)16)8-5-3-6-9(7-8)15(17)18/h3,5-7H,2,4H2,1H3,(H3,12,14,16)/b13-10- |
| InChIKey | NNNYLJQOHUTSKY-RAXLEYEMSA-N |
| XLogP | 1.77 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|