About [(Z)-[2-amino-1-(3-nitrophenyl)ethylidene]amino]thiourea;hydrobromide
[(Z)-[2-amino-1-(3-nitrophenyl)ethylidene]amino]thiourea;hydrobromide (PubChem CID 73355257) has the molecular formula C9H12BrN5O2S
and a molecular weight of 334.20 g/mol. Its IUPAC name is [(Z)-[2-amino-1-(3-nitrophenyl)ethylidene]amino]thiourea;hydrobromide.
Molecular Properties
| Compound Name | [(Z)-[2-amino-1-(3-nitrophenyl)ethylidene]amino]thiourea;hydrobromide |
| PubChem CID | 73355257 |
| Molecular Formula | C9H12BrN5O2S |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 332.99 |
| IUPAC Name | [(Z)-[2-amino-1-(3-nitrophenyl)ethylidene]amino]thiourea;hydrobromide |
| SMILES | Br.NC/C(=N\NC(N)=S)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H11N5O2S.BrH/c10-5-8(12-13-9(11)17)6-2-1-3-7(4-6)14(15)16;/h1-4H,5,10H2,(H3,11,13,17);1H/b12-8+; |
| InChIKey | JXVGNNBDZQLCNB-MXZHIVQLSA-N |
| XLogP | 0.67 |
| TPSA | 119.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-[2-amino-1-(3-nitrophenyl)ethylidene]amino]thiourea;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-[2-amino-1-(3-nitrophenyl)ethylidene]amino]thiourea;hydrobromide?
The IUPAC name of [(Z)-[2-amino-1-(3-nitrophenyl)ethylidene]amino]thiourea;hydrobromide (CID 73355257) is [(Z)-[2-amino-1-(3-nitrophenyl)ethylidene]amino]thiourea;hydrobromide.
What is the SMILES notation for [(Z)-[2-amino-1-(3-nitrophenyl)ethylidene]amino]thiourea;hydrobromide?
The canonical SMILES for [(Z)-[2-amino-1-(3-nitrophenyl)ethylidene]amino]thiourea;hydrobromide is Br.NC/C(=N\NC(N)=S)c1cccc([N+](=O)[O-])c1.
What is the InChIKey of [(Z)-[2-amino-1-(3-nitrophenyl)ethylidene]amino]thiourea;hydrobromide?
The InChIKey is JXVGNNBDZQLCNB-MXZHIVQLSA-N. The full InChI is InChI=1S/C9H11N5O2S.BrH/c10-5-8(12-13-9(11)17)6-2-1-3-7(4-6)14(15)16;/h1-4H,5,10H2,(H3,11,13,17);1H/b12-8+;.
What are the key properties of [(Z)-[2-amino-1-(3-nitrophenyl)ethylidene]amino]thiourea;hydrobromide?
[(Z)-[2-amino-1-(3-nitrophenyl)ethylidene]amino]thiourea;hydrobromide has a molecular weight of 334.20 g/mol, XLogP of 0.67, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-[2-amino-1-(3-nitrophenyl)ethylidene]amino]thiourea;hydrobromide is sourced from PubChem (CID 73355257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).