C14H18O2S — CID 170480030
S-[4-[4-(hydroxymethyl)-3-methylphenyl]but-3-enyl] ethanethioate (PubChem CID 170480030) has the molecular formula C14H18O2S and a molecular weight of 250.36 g/mol. Its IUPAC name is S-[4-[4-(hydroxymethyl)-3-methylphenyl]but-3-enyl] ethanethioate.
| Compound Name | S-[4-[4-(hydroxymethyl)-3-methylphenyl]but-3-enyl] ethanethioate |
|---|---|
| PubChem CID | 170480030 |
| Molecular Formula | C14H18O2S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | S-[4-[4-(hydroxymethyl)-3-methylphenyl]but-3-enyl] ethanethioate |
| SMILES | CC(=O)SCCC=Cc1ccc(CO)c(C)c1 |
| InChI | InChI=1S/C14H18O2S/c1-11-9-13(6-7-14(11)10-15)5-3-4-8-17-12(2)16/h3,5-7,9,15H,4,8,10H2,1-2H3 |
| InChIKey | CJLMRDYSIOFUCW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|