C10H11FN4O2S — CID 170485921
4-(4-azidobut-1-enyl)-3-fluorobenzenesulfonamide (PubChem CID 170485921) has the molecular formula C10H11FN4O2S and a molecular weight of 270.29 g/mol. Its IUPAC name is 4-(4-azidobut-1-enyl)-3-fluorobenzenesulfonamide.
| Compound Name | 4-(4-azidobut-1-enyl)-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 170485921 |
| Molecular Formula | C10H11FN4O2S |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 4-(4-azidobut-1-enyl)-3-fluorobenzenesulfonamide |
| SMILES | [N-]=[N+]=NCCC=Cc1ccc(S(N)(=O)=O)cc1F |
| InChI | InChI=1S/C10H11FN4O2S/c11-10-7-9(18(13,16)17)5-4-8(10)3-1-2-6-14-15-12/h1,3-5,7H,2,6H2,(H2,13,16,17) |
| InChIKey | BUNLREBDQJFARZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|