C11H12ClF3N2 — CID 170496369
4-[6-chloro-5-(trifluoromethyl)-3-pyridinyl]-N-methylbut-3-en-1-amine (PubChem CID 170496369) has the molecular formula C11H12ClF3N2 and a molecular weight of 264.68 g/mol. Its IUPAC name is 4-[6-chloro-5-(trifluoromethyl)-3-pyridinyl]-N-methylbut-3-en-1-amine.
| Compound Name | 4-[6-chloro-5-(trifluoromethyl)-3-pyridinyl]-N-methylbut-3-en-1-amine |
|---|---|
| PubChem CID | 170496369 |
| Molecular Formula | C11H12ClF3N2 |
| Molecular Weight | 264.68 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 4-[6-chloro-5-(trifluoromethyl)-3-pyridinyl]-N-methylbut-3-en-1-amine |
| SMILES | CNCCC=Cc1cnc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H12ClF3N2/c1-16-5-3-2-4-8-6-9(11(13,14)15)10(12)17-7-8/h2,4,6-7,16H,3,5H2,1H3 |
| InChIKey | XRRPELYMPOYYSW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.68 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|