C11H13ClN2O2 — CID 170496138
2-chloro-5-[4-(methylamino)but-1-enyl]pyridine-3-carboxylic acid (PubChem CID 170496138) has the molecular formula C11H13ClN2O2 and a molecular weight of 240.69 g/mol. Its IUPAC name is 2-chloro-5-[4-(methylamino)but-1-enyl]pyridine-3-carboxylic acid.
| Compound Name | 2-chloro-5-[4-(methylamino)but-1-enyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 170496138 |
| Molecular Formula | C11H13ClN2O2 |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 2-chloro-5-[4-(methylamino)but-1-enyl]pyridine-3-carboxylic acid |
| SMILES | CNCCC=Cc1cnc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H13ClN2O2/c1-13-5-3-2-4-8-6-9(11(15)16)10(12)14-7-8/h2,4,6-7,13H,3,5H2,1H3,(H,15,16) |
| InChIKey | SVPYDNBPYFEAHZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|