C10H13NO2S — CID 170495337
4-[4-(methylamino)but-1-enyl]thiophene-2-carboxylic acid (PubChem CID 170495337) has the molecular formula C10H13NO2S and a molecular weight of 211.29 g/mol. Its IUPAC name is 4-[4-(methylamino)but-1-enyl]thiophene-2-carboxylic acid.
| Compound Name | 4-[4-(methylamino)but-1-enyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 170495337 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | 4-[4-(methylamino)but-1-enyl]thiophene-2-carboxylic acid |
| SMILES | CNCCC=Cc1csc(C(=O)O)c1 |
| InChI | InChI=1S/C10H13NO2S/c1-11-5-3-2-4-8-6-9(10(12)13)14-7-8/h2,4,6-7,11H,3,5H2,1H3,(H,12,13) |
| InChIKey | JCBCJPYMQXJTBV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|