C11H13ClFN — CID 170495335
4-(3-chloro-4-fluorophenyl)-N-methylbut-3-en-1-amine (PubChem CID 170495335) has the molecular formula C11H13ClFN and a molecular weight of 213.68 g/mol. Its IUPAC name is 4-(3-chloro-4-fluorophenyl)-N-methylbut-3-en-1-amine.
| Compound Name | 4-(3-chloro-4-fluorophenyl)-N-methylbut-3-en-1-amine |
|---|---|
| PubChem CID | 170495335 |
| Molecular Formula | C11H13ClFN |
| Molecular Weight | 213.68 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | 4-(3-chloro-4-fluorophenyl)-N-methylbut-3-en-1-amine |
| SMILES | CNCCC=Cc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C11H13ClFN/c1-14-7-3-2-4-9-5-6-11(13)10(12)8-9/h2,4-6,8,14H,3,7H2,1H3 |
| InChIKey | MICMHKQWDGTUTP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.68 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|