C13H15FN2 — CID 170496128
2-[2-fluoro-4-[4-(methylamino)but-1-enyl]phenyl]acetonitrile (PubChem CID 170496128) has the molecular formula C13H15FN2 and a molecular weight of 218.27 g/mol. Its IUPAC name is 2-[2-fluoro-4-[4-(methylamino)but-1-enyl]phenyl]acetonitrile.
| Compound Name | 2-[2-fluoro-4-[4-(methylamino)but-1-enyl]phenyl]acetonitrile |
|---|---|
| PubChem CID | 170496128 |
| Molecular Formula | C13H15FN2 |
| Molecular Weight | 218.27 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 2-[2-fluoro-4-[4-(methylamino)but-1-enyl]phenyl]acetonitrile |
| SMILES | CNCCC=Cc1ccc(CC#N)c(F)c1 |
| InChI | InChI=1S/C13H15FN2/c1-16-9-3-2-4-11-5-6-12(7-8-15)13(14)10-11/h2,4-6,10,16H,3,7,9H2,1H3 |
| InChIKey | MZJXXIXFOIVYHS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|