C10H6BrCl2F3 — CID 169476243
2-(3-bromoprop-1-enyl)-1,3-dichloro-5-(trifluoromethyl)benzene (PubChem CID 169476243) has the molecular formula C10H6BrCl2F3 and a molecular weight of 333.96 g/mol. Its IUPAC name is 2-(3-bromoprop-1-enyl)-1,3-dichloro-5-(trifluoromethyl)benzene.
| Compound Name | 2-(3-bromoprop-1-enyl)-1,3-dichloro-5-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 169476243 |
| Molecular Formula | C10H6BrCl2F3 |
| Molecular Weight | 333.96 g/mol |
| Exact Mass | 331.90 |
| IUPAC Name | 2-(3-bromoprop-1-enyl)-1,3-dichloro-5-(trifluoromethyl)benzene |
| SMILES | FC(F)(F)c1cc(Cl)c(C=CCBr)c(Cl)c1 |
| InChI | InChI=1S/C10H6BrCl2F3/c11-3-1-2-7-8(12)4-6(5-9(7)13)10(14,15)16/h1-2,4-5H,3H2 |
| InChIKey | VPWKEIGILNTMBY-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.96 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|