C11H6Cl2F3N — CID 170800501
4-[2,6-dichloro-4-(trifluoromethyl)phenyl]but-3-enenitrile (PubChem CID 170800501) has the molecular formula C11H6Cl2F3N and a molecular weight of 280.08 g/mol. Its IUPAC name is 4-[2,6-dichloro-4-(trifluoromethyl)phenyl]but-3-enenitrile.
| Compound Name | 4-[2,6-dichloro-4-(trifluoromethyl)phenyl]but-3-enenitrile |
|---|---|
| PubChem CID | 170800501 |
| Molecular Formula | C11H6Cl2F3N |
| Molecular Weight | 280.08 g/mol |
| Exact Mass | 278.98 |
| IUPAC Name | 4-[2,6-dichloro-4-(trifluoromethyl)phenyl]but-3-enenitrile |
| SMILES | N#CCC=Cc1c(Cl)cc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C11H6Cl2F3N/c12-9-5-7(11(14,15)16)6-10(13)8(9)3-1-2-4-17/h1,3,5-6H,2H2 |
| InChIKey | PDTZDZJILBKWJT-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.08 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |