C11H12Br2FN — CID 170496822
4-(2,6-dibromo-4-fluorophenyl)-N-methylbut-3-en-1-amine (PubChem CID 170496822) has the molecular formula C11H12Br2FN and a molecular weight of 337.03 g/mol. Its IUPAC name is 4-(2,6-dibromo-4-fluorophenyl)-N-methylbut-3-en-1-amine.
| Compound Name | 4-(2,6-dibromo-4-fluorophenyl)-N-methylbut-3-en-1-amine |
|---|---|
| PubChem CID | 170496822 |
| Molecular Formula | C11H12Br2FN |
| Molecular Weight | 337.03 g/mol |
| Exact Mass | 334.93 |
| IUPAC Name | 4-(2,6-dibromo-4-fluorophenyl)-N-methylbut-3-en-1-amine |
| SMILES | CNCCC=Cc1c(Br)cc(F)cc1Br |
| InChI | InChI=1S/C11H12Br2FN/c1-15-5-3-2-4-9-10(12)6-8(14)7-11(9)13/h2,4,6-7,15H,3,5H2,1H3 |
| InChIKey | CGJCNLDCHLCYJC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.03 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|