C9H10Br2N2 — CID 169474904
3-(3,5-dibromo-4-pyridinyl)-N-methylprop-2-en-1-amine (PubChem CID 169474904) has the molecular formula C9H10Br2N2 and a molecular weight of 306.00 g/mol. Its IUPAC name is 3-(3,5-dibromo-4-pyridinyl)-N-methylprop-2-en-1-amine.
| Compound Name | 3-(3,5-dibromo-4-pyridinyl)-N-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 169474904 |
| Molecular Formula | C9H10Br2N2 |
| Molecular Weight | 306.00 g/mol |
| Exact Mass | 303.92 |
| IUPAC Name | 3-(3,5-dibromo-4-pyridinyl)-N-methylprop-2-en-1-amine |
| SMILES | CNCC=Cc1c(Br)cncc1Br |
| InChI | InChI=1S/C9H10Br2N2/c1-12-4-2-3-7-8(10)5-13-6-9(7)11/h2-3,5-6,12H,4H2,1H3 |
| InChIKey | JQDBDLLCBRCRNC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.00 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |