C8H11N3O — CID 169473083
5-[3-(methylamino)prop-1-enyl]-1H-pyrimidin-6-one (PubChem CID 169473083) has the molecular formula C8H11N3O and a molecular weight of 165.20 g/mol. Its IUPAC name is 5-[3-(methylamino)prop-1-enyl]-1H-pyrimidin-6-one.
| Compound Name | 5-[3-(methylamino)prop-1-enyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 169473083 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 5-[3-(methylamino)prop-1-enyl]-1H-pyrimidin-6-one |
| SMILES | CNCC=Cc1cnc[nH]c1=O |
| InChI | InChI=1S/C8H11N3O/c1-9-4-2-3-7-5-10-6-11-8(7)12/h2-3,5-6,9H,4H2,1H3,(H,10,11,12) |
| InChIKey | IOLQBYKYAWWMGD-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |