C7H10N2O2 — CID 119094005
5-(ethoxymethyl)-1H-pyrimidin-6-one (PubChem CID 119094005) has the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. Its IUPAC name is 5-(ethoxymethyl)-1H-pyrimidin-6-one.
| Compound Name | 5-(ethoxymethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 119094005 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 5-(ethoxymethyl)-1H-pyrimidin-6-one |
| SMILES | CCOCc1cnc[nH]c1=O |
| InChI | InChI=1S/C7H10N2O2/c1-2-11-4-6-3-8-5-9-7(6)10/h3,5H,2,4H2,1H3,(H,8,9,10) |
| InChIKey | ZIRWIOYGAAZKJB-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |