C9H12N2O5 — CID 171865577
ethyl 2,3-dihydroxy-3-(6-oxo-1H-pyrimidin-5-yl)propanoate (PubChem CID 171865577) has the molecular formula C9H12N2O5 and a molecular weight of 228.20 g/mol. Its IUPAC name is ethyl 2,3-dihydroxy-3-(6-oxo-1H-pyrimidin-5-yl)propanoate.
| Compound Name | ethyl 2,3-dihydroxy-3-(6-oxo-1H-pyrimidin-5-yl)propanoate |
|---|---|
| PubChem CID | 171865577 |
| Molecular Formula | C9H12N2O5 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | ethyl 2,3-dihydroxy-3-(6-oxo-1H-pyrimidin-5-yl)propanoate |
| SMILES | CCOC(=O)C(O)C(O)c1cnc[nH]c1=O |
| InChI | InChI=1S/C9H12N2O5/c1-2-16-9(15)7(13)6(12)5-3-10-4-11-8(5)14/h3-4,6-7,12-13H,2H2,1H3,(H,10,11,14) |
| InChIKey | BZWWNDGUNLEXRP-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 112.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |