C8H13N3O3 — CID 171857429
5-[1,2-dihydroxy-3-(methylamino)propyl]-1H-pyrimidin-6-one (PubChem CID 171857429) has the molecular formula C8H13N3O3 and a molecular weight of 199.21 g/mol. Its IUPAC name is 5-[1,2-dihydroxy-3-(methylamino)propyl]-1H-pyrimidin-6-one.
| Compound Name | 5-[1,2-dihydroxy-3-(methylamino)propyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 171857429 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 5-[1,2-dihydroxy-3-(methylamino)propyl]-1H-pyrimidin-6-one |
| SMILES | CNCC(O)C(O)c1cnc[nH]c1=O |
| InChI | InChI=1S/C8H13N3O3/c1-9-3-6(12)7(13)5-2-10-4-11-8(5)14/h2,4,6-7,9,12-13H,3H2,1H3,(H,10,11,14) |
| InChIKey | HRRVAYONJWTRER-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 98.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |