About 5-(4-amino-1,2-dihydroxybutyl)-1H-pyrimidin-6-one
5-(4-amino-1,2-dihydroxybutyl)-1H-pyrimidin-6-one (PubChem CID 171880720) has the molecular formula C8H13N3O3
and a molecular weight of 199.21 g/mol. Its IUPAC name is 5-(4-amino-1,2-dihydroxybutyl)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 5-(4-amino-1,2-dihydroxybutyl)-1H-pyrimidin-6-one |
| PubChem CID | 171880720 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 5-(4-amino-1,2-dihydroxybutyl)-1H-pyrimidin-6-one |
| SMILES | NCCC(O)C(O)c1cnc[nH]c1=O |
| InChI | InChI=1S/C8H13N3O3/c9-2-1-6(12)7(13)5-3-10-4-11-8(5)14/h3-4,6-7,12-13H,1-2,9H2,(H,10,11,14) |
| InChIKey | VHDMXBNULQESDJ-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 112.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(4-amino-1,2-dihydroxybutyl)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-amino-1,2-dihydroxybutyl)-1H-pyrimidin-6-one?
The IUPAC name of 5-(4-amino-1,2-dihydroxybutyl)-1H-pyrimidin-6-one (CID 171880720) is 5-(4-amino-1,2-dihydroxybutyl)-1H-pyrimidin-6-one.
What is the SMILES notation for 5-(4-amino-1,2-dihydroxybutyl)-1H-pyrimidin-6-one?
The canonical SMILES for 5-(4-amino-1,2-dihydroxybutyl)-1H-pyrimidin-6-one is NCCC(O)C(O)c1cnc[nH]c1=O.
What is the InChIKey of 5-(4-amino-1,2-dihydroxybutyl)-1H-pyrimidin-6-one?
The InChIKey is VHDMXBNULQESDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O3/c9-2-1-6(12)7(13)5-3-10-4-11-8(5)14/h3-4,6-7,12-13H,1-2,9H2,(H,10,11,14).
What are the key properties of 5-(4-amino-1,2-dihydroxybutyl)-1H-pyrimidin-6-one?
5-(4-amino-1,2-dihydroxybutyl)-1H-pyrimidin-6-one has a molecular weight of 199.21 g/mol, XLogP of -1.49, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-amino-1,2-dihydroxybutyl)-1H-pyrimidin-6-one is sourced from PubChem (CID 171880720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).