C10H16N2O3 — CID 171881026
5-(4-amino-1,2-dihydroxybutyl)-3-methyl-1H-pyridin-2-one (PubChem CID 171881026) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 5-(4-amino-1,2-dihydroxybutyl)-3-methyl-1H-pyridin-2-one.
| Compound Name | 5-(4-amino-1,2-dihydroxybutyl)-3-methyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 171881026 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 5-(4-amino-1,2-dihydroxybutyl)-3-methyl-1H-pyridin-2-one |
| SMILES | Cc1cc(C(O)C(O)CCN)c[nH]c1=O |
| InChI | InChI=1S/C10H16N2O3/c1-6-4-7(5-12-10(6)15)9(14)8(13)2-3-11/h4-5,8-9,13-14H,2-3,11H2,1H3,(H,12,15) |
| InChIKey | HZJGWMGMJYCFGV-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |