C8H11BrN2O3 — CID 171859671
3-amino-5-(3-bromo-1,2-dihydroxypropyl)-1H-pyridin-2-one (PubChem CID 171859671) has the molecular formula C8H11BrN2O3 and a molecular weight of 263.09 g/mol. Its IUPAC name is 3-amino-5-(3-bromo-1,2-dihydroxypropyl)-1H-pyridin-2-one.
| Compound Name | 3-amino-5-(3-bromo-1,2-dihydroxypropyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 171859671 |
| Molecular Formula | C8H11BrN2O3 |
| Molecular Weight | 263.09 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 3-amino-5-(3-bromo-1,2-dihydroxypropyl)-1H-pyridin-2-one |
| SMILES | Nc1cc(C(O)C(O)CBr)c[nH]c1=O |
| InChI | InChI=1S/C8H11BrN2O3/c9-2-6(12)7(13)4-1-5(10)8(14)11-3-4/h1,3,6-7,12-13H,2,10H2,(H,11,14) |
| InChIKey | OFLJBZDEFZZPTM-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.09 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|