C10H15N3O5 — CID 171890616
5-[1,2-dihydroxy-4-(methylamino)butyl]-3-nitro-1H-pyridin-2-one (PubChem CID 171890616) has the molecular formula C10H15N3O5 and a molecular weight of 257.25 g/mol. Its IUPAC name is 5-[1,2-dihydroxy-4-(methylamino)butyl]-3-nitro-1H-pyridin-2-one.
| Compound Name | 5-[1,2-dihydroxy-4-(methylamino)butyl]-3-nitro-1H-pyridin-2-one |
|---|---|
| PubChem CID | 171890616 |
| Molecular Formula | C10H15N3O5 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 5-[1,2-dihydroxy-4-(methylamino)butyl]-3-nitro-1H-pyridin-2-one |
| SMILES | CNCCC(O)C(O)c1c[nH]c(=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H15N3O5/c1-11-3-2-8(14)9(15)6-4-7(13(17)18)10(16)12-5-6/h4-5,8-9,11,14-15H,2-3H2,1H3,(H,12,16) |
| InChIKey | UAOUELKOCCTBAE-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 128.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|