C9H15N3O4 — CID 171889901
5-[1,2-dihydroxy-4-(methylamino)butyl]-1H-pyrimidine-2,4-dione (PubChem CID 171889901) has the molecular formula C9H15N3O4 and a molecular weight of 229.24 g/mol. Its IUPAC name is 5-[1,2-dihydroxy-4-(methylamino)butyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[1,2-dihydroxy-4-(methylamino)butyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 171889901 |
| Molecular Formula | C9H15N3O4 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 5-[1,2-dihydroxy-4-(methylamino)butyl]-1H-pyrimidine-2,4-dione |
| SMILES | CNCCC(O)C(O)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H15N3O4/c1-10-3-2-6(13)7(14)5-4-11-9(16)12-8(5)15/h4,6-7,10,13-14H,2-3H2,1H3,(H2,11,12,15,16) |
| InChIKey | DEMQOIFWCVAHCX-UHFFFAOYSA-N |
| XLogP | -1.93 |
| TPSA | 118.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |