C13H16N2O5 — CID 171891058
5-[1,2-dihydroxy-4-(methylamino)butyl]-1H-3,1-benzoxazine-2,4-dione (PubChem CID 171891058) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is 5-[1,2-dihydroxy-4-(methylamino)butyl]-1H-3,1-benzoxazine-2,4-dione.
| Compound Name | 5-[1,2-dihydroxy-4-(methylamino)butyl]-1H-3,1-benzoxazine-2,4-dione |
|---|---|
| PubChem CID | 171891058 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 5-[1,2-dihydroxy-4-(methylamino)butyl]-1H-3,1-benzoxazine-2,4-dione |
| SMILES | CNCCC(O)C(O)c1cccc2[nH]c(=O)oc(=O)c12 |
| InChI | InChI=1S/C13H16N2O5/c1-14-6-5-9(16)11(17)7-3-2-4-8-10(7)12(18)20-13(19)15-8/h2-4,9,11,14,16-17H,5-6H2,1H3,(H,15,19) |
| InChIKey | KQMFCYJXWIUVBS-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |