C11H11NO5S — CID 170820717
5-(1,2-dihydroxy-3-sulfanylpropyl)-1H-3,1-benzoxazine-2,4-dione (PubChem CID 170820717) has the molecular formula C11H11NO5S and a molecular weight of 269.28 g/mol. Its IUPAC name is 5-(1,2-dihydroxy-3-sulfanylpropyl)-1H-3,1-benzoxazine-2,4-dione.
| Compound Name | 5-(1,2-dihydroxy-3-sulfanylpropyl)-1H-3,1-benzoxazine-2,4-dione |
|---|---|
| PubChem CID | 170820717 |
| Molecular Formula | C11H11NO5S |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 5-(1,2-dihydroxy-3-sulfanylpropyl)-1H-3,1-benzoxazine-2,4-dione |
| SMILES | O=c1[nH]c2cccc(C(O)C(O)CS)c2c(=O)o1 |
| InChI | InChI=1S/C11H11NO5S/c13-7(4-18)9(14)5-2-1-3-6-8(5)10(15)17-11(16)12-6/h1-3,7,9,13-14,18H,4H2,(H,12,16) |
| InChIKey | CAJONWKHHGBRIN-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|