About 2-hydroxy-2-(2-oxo-3H-1,3-benzoxazol-7-yl)acetic acid
2-hydroxy-2-(2-oxo-3H-1,3-benzoxazol-7-yl)acetic acid (PubChem CID 131403905) has the molecular formula C9H7NO5
and a molecular weight of 209.16 g/mol. Its IUPAC name is 2-hydroxy-2-(2-oxo-3H-1,3-benzoxazol-7-yl)acetic acid.
Molecular Properties
| Compound Name | 2-hydroxy-2-(2-oxo-3H-1,3-benzoxazol-7-yl)acetic acid |
| PubChem CID | 131403905 |
| Molecular Formula | C9H7NO5 |
| Molecular Weight | 209.16 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | 2-hydroxy-2-(2-oxo-3H-1,3-benzoxazol-7-yl)acetic acid |
| SMILES | O=C(O)C(O)c1cccc2[nH]c(=O)oc12 |
| InChI | InChI=1S/C9H7NO5/c11-6(8(12)13)4-2-1-3-5-7(4)15-9(14)10-5/h1-3,6,11H,(H,10,14)(H,12,13) |
| InChIKey | NTTVNKBPNCZVEF-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.16 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-hydroxy-2-(2-oxo-3H-1,3-benzoxazol-7-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-2-(2-oxo-3H-1,3-benzoxazol-7-yl)acetic acid?
The IUPAC name of 2-hydroxy-2-(2-oxo-3H-1,3-benzoxazol-7-yl)acetic acid (CID 131403905) is 2-hydroxy-2-(2-oxo-3H-1,3-benzoxazol-7-yl)acetic acid.
What is the SMILES notation for 2-hydroxy-2-(2-oxo-3H-1,3-benzoxazol-7-yl)acetic acid?
The canonical SMILES for 2-hydroxy-2-(2-oxo-3H-1,3-benzoxazol-7-yl)acetic acid is O=C(O)C(O)c1cccc2[nH]c(=O)oc12.
What is the InChIKey of 2-hydroxy-2-(2-oxo-3H-1,3-benzoxazol-7-yl)acetic acid?
The InChIKey is NTTVNKBPNCZVEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO5/c11-6(8(12)13)4-2-1-3-5-7(4)15-9(14)10-5/h1-3,6,11H,(H,10,14)(H,12,13).
What are the key properties of 2-hydroxy-2-(2-oxo-3H-1,3-benzoxazol-7-yl)acetic acid?
2-hydroxy-2-(2-oxo-3H-1,3-benzoxazol-7-yl)acetic acid has a molecular weight of 209.16 g/mol, XLogP of 0.24, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2-(2-oxo-3H-1,3-benzoxazol-7-yl)acetic acid is sourced from PubChem (CID 131403905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).