C9H6ClNO4 — CID 131605647
2-(2-chloro-1,3-benzoxazol-7-yl)-2-hydroxyacetic acid (PubChem CID 131605647) has the molecular formula C9H6ClNO4 and a molecular weight of 227.60 g/mol. Its IUPAC name is 2-(2-chloro-1,3-benzoxazol-7-yl)-2-hydroxyacetic acid.
| Compound Name | 2-(2-chloro-1,3-benzoxazol-7-yl)-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 131605647 |
| Molecular Formula | C9H6ClNO4 |
| Molecular Weight | 227.60 g/mol |
| Exact Mass | 227.00 |
| IUPAC Name | 2-(2-chloro-1,3-benzoxazol-7-yl)-2-hydroxyacetic acid |
| SMILES | O=C(O)C(O)c1cccc2nc(Cl)oc12 |
| InChI | InChI=1S/C9H6ClNO4/c10-9-11-5-3-1-2-4(7(5)15-9)6(12)8(13)14/h1-3,6,12H,(H,13,14) |
| InChIKey | DKEUWFHTNIKVCF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.60 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |