2-(2-chloro-1,3-benzoxazol-7-yl)-2-hydroxyacetic acid

C9H6ClNO4 — CID 131605647

IUPAC2-(2-chloro-1,3-benzoxazol-7-yl)-2-hydroxyacetic acid
SMILESO=C(O)C(O)c1cccc2nc(Cl)oc12
InChIInChI=1S/C9H6ClNO4/c10-9-11-5-3-1-2-4(7(5)15-9)6(12)8(13)14/h1-3,6,12H,(H,13,14)
InChIKeyDKEUWFHTNIKVCF-UHFFFAOYSA-N
MW227.60 g/mol
LogP1.60
Rot. Bonds2

About 2-(2-chloro-1,3-benzoxazol-7-yl)-2-hydroxyacetic acid

2-(2-chloro-1,3-benzoxazol-7-yl)-2-hydroxyacetic acid (PubChem CID 131605647) has the molecular formula C9H6ClNO4 and a molecular weight of 227.60 g/mol. Its IUPAC name is 2-(2-chloro-1,3-benzoxazol-7-yl)-2-hydroxyacetic acid.

Molecular Properties

Compound Name2-(2-chloro-1,3-benzoxazol-7-yl)-2-hydroxyacetic acid
PubChem CID131605647
Molecular FormulaC9H6ClNO4
Molecular Weight227.60 g/mol
Exact Mass227.00
IUPAC Name2-(2-chloro-1,3-benzoxazol-7-yl)-2-hydroxyacetic acid
SMILESO=C(O)C(O)c1cccc2nc(Cl)oc12
InChIInChI=1S/C9H6ClNO4/c10-9-11-5-3-1-2-4(7(5)15-9)6(12)8(13)14/h1-3,6,12H,(H,13,14)
InChIKeyDKEUWFHTNIKVCF-UHFFFAOYSA-N
XLogP1.60
TPSA83.56 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.60
LogP ≤ 51.60
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(2-chloro-1,3-benzoxazol-7-yl)-2-hydroxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-chloro-1,3-benzoxazol-7-yl)-2-hydroxyacetic acid?
The IUPAC name of 2-(2-chloro-1,3-benzoxazol-7-yl)-2-hydroxyacetic acid (CID 131605647) is 2-(2-chloro-1,3-benzoxazol-7-yl)-2-hydroxyacetic acid.
What is the SMILES notation for 2-(2-chloro-1,3-benzoxazol-7-yl)-2-hydroxyacetic acid?
The canonical SMILES for 2-(2-chloro-1,3-benzoxazol-7-yl)-2-hydroxyacetic acid is O=C(O)C(O)c1cccc2nc(Cl)oc12.
What is the InChIKey of 2-(2-chloro-1,3-benzoxazol-7-yl)-2-hydroxyacetic acid?
The InChIKey is DKEUWFHTNIKVCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClNO4/c10-9-11-5-3-1-2-4(7(5)15-9)6(12)8(13)14/h1-3,6,12H,(H,13,14).
What are the key properties of 2-(2-chloro-1,3-benzoxazol-7-yl)-2-hydroxyacetic acid?
2-(2-chloro-1,3-benzoxazol-7-yl)-2-hydroxyacetic acid has a molecular weight of 227.60 g/mol, XLogP of 1.60, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chloro-1,3-benzoxazol-7-yl)-2-hydroxyacetic acid is sourced from PubChem (CID 131605647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).