C14H8ClNO3 — CID 59625768
2-(4-chlorophenyl)-1,3-benzoxazole-7-carboxylic acid (PubChem CID 59625768) has the molecular formula C14H8ClNO3 and a molecular weight of 273.68 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1,3-benzoxazole-7-carboxylic acid.
| Compound Name | 2-(4-chlorophenyl)-1,3-benzoxazole-7-carboxylic acid |
|---|---|
| PubChem CID | 59625768 |
| Molecular Formula | C14H8ClNO3 |
| Molecular Weight | 273.68 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 2-(4-chlorophenyl)-1,3-benzoxazole-7-carboxylic acid |
| SMILES | O=C(O)c1cccc2nc(-c3ccc(Cl)cc3)oc12 |
| InChI | InChI=1S/C14H8ClNO3/c15-9-6-4-8(5-7-9)13-16-11-3-1-2-10(14(17)18)12(11)19-13/h1-7H,(H,17,18) |
| InChIKey | LHMCEUIMRLAVAQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.68 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |