2-cyano-1,3-benzoxazole-7-carboxylic acid

C9H4N2O3 — CID 131011125

IUPAC2-cyano-1,3-benzoxazole-7-carboxylic acid
SMILESN#Cc1nc2cccc(C(=O)O)c2o1
InChIInChI=1S/C9H4N2O3/c10-4-7-11-6-3-1-2-5(9(12)13)8(6)14-7/h1-3H,(H,12,13)
InChIKeyCDZLOOQGDQWOHV-UHFFFAOYSA-N
MW188.14 g/mol
LogP1.40
Rot. Bonds1

About 2-cyano-1,3-benzoxazole-7-carboxylic acid

2-cyano-1,3-benzoxazole-7-carboxylic acid (PubChem CID 131011125) has the molecular formula C9H4N2O3 and a molecular weight of 188.14 g/mol. Its IUPAC name is 2-cyano-1,3-benzoxazole-7-carboxylic acid.

Molecular Properties

Compound Name2-cyano-1,3-benzoxazole-7-carboxylic acid
PubChem CID131011125
Molecular FormulaC9H4N2O3
Molecular Weight188.14 g/mol
Exact Mass188.02
IUPAC Name2-cyano-1,3-benzoxazole-7-carboxylic acid
SMILESN#Cc1nc2cccc(C(=O)O)c2o1
InChIInChI=1S/C9H4N2O3/c10-4-7-11-6-3-1-2-5(9(12)13)8(6)14-7/h1-3H,(H,12,13)
InChIKeyCDZLOOQGDQWOHV-UHFFFAOYSA-N
XLogP1.40
TPSA87.12 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.14
LogP ≤ 51.40
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-cyano-1,3-benzoxazole-7-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-cyano-1,3-benzoxazole-7-carboxylic acid?
The IUPAC name of 2-cyano-1,3-benzoxazole-7-carboxylic acid (CID 131011125) is 2-cyano-1,3-benzoxazole-7-carboxylic acid.
What is the SMILES notation for 2-cyano-1,3-benzoxazole-7-carboxylic acid?
The canonical SMILES for 2-cyano-1,3-benzoxazole-7-carboxylic acid is N#Cc1nc2cccc(C(=O)O)c2o1.
What is the InChIKey of 2-cyano-1,3-benzoxazole-7-carboxylic acid?
The InChIKey is CDZLOOQGDQWOHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4N2O3/c10-4-7-11-6-3-1-2-5(9(12)13)8(6)14-7/h1-3H,(H,12,13).
What are the key properties of 2-cyano-1,3-benzoxazole-7-carboxylic acid?
2-cyano-1,3-benzoxazole-7-carboxylic acid has a molecular weight of 188.14 g/mol, XLogP of 1.40, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-1,3-benzoxazole-7-carboxylic acid is sourced from PubChem (CID 131011125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).