C13H13NO3 — CID 103167556
2-(cyclobutylmethyl)-1,3-benzoxazole-7-carboxylic acid (PubChem CID 103167556) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is 2-(cyclobutylmethyl)-1,3-benzoxazole-7-carboxylic acid.
| Compound Name | 2-(cyclobutylmethyl)-1,3-benzoxazole-7-carboxylic acid |
|---|---|
| PubChem CID | 103167556 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 2-(cyclobutylmethyl)-1,3-benzoxazole-7-carboxylic acid |
| SMILES | O=C(O)c1cccc2nc(CC3CCC3)oc12 |
| InChI | InChI=1S/C13H13NO3/c15-13(16)9-5-2-6-10-12(9)17-11(14-10)7-8-3-1-4-8/h2,5-6,8H,1,3-4,7H2,(H,15,16) |
| InChIKey | BKGIDFQEUNHHIN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |