C15H13NO3S — CID 81346812
2-(3-thiophen-2-ylpropyl)-1,3-benzoxazole-7-carboxylic acid (PubChem CID 81346812) has the molecular formula C15H13NO3S and a molecular weight of 287.34 g/mol. Its IUPAC name is 2-(3-thiophen-2-ylpropyl)-1,3-benzoxazole-7-carboxylic acid.
| Compound Name | 2-(3-thiophen-2-ylpropyl)-1,3-benzoxazole-7-carboxylic acid |
|---|---|
| PubChem CID | 81346812 |
| Molecular Formula | C15H13NO3S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 2-(3-thiophen-2-ylpropyl)-1,3-benzoxazole-7-carboxylic acid |
| SMILES | O=C(O)c1cccc2nc(CCCc3cccs3)oc12 |
| InChI | InChI=1S/C15H13NO3S/c17-15(18)11-6-2-7-12-14(11)19-13(16-12)8-1-4-10-5-3-9-20-10/h2-3,5-7,9H,1,4,8H2,(H,17,18) |
| InChIKey | GWTAFSGWHSPRMA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |