C9H9N3O2 — CID 118853991
2-(aminomethyl)-1,3-benzoxazole-7-carboxamide (PubChem CID 118853991) has the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. Its IUPAC name is 2-(aminomethyl)-1,3-benzoxazole-7-carboxamide.
| Compound Name | 2-(aminomethyl)-1,3-benzoxazole-7-carboxamide |
|---|---|
| PubChem CID | 118853991 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 2-(aminomethyl)-1,3-benzoxazole-7-carboxamide |
| SMILES | NCc1nc2cccc(C(N)=O)c2o1 |
| InChI | InChI=1S/C9H9N3O2/c10-4-7-12-6-3-1-2-5(9(11)13)8(6)14-7/h1-3H,4,10H2,(H2,11,13) |
| InChIKey | HBNFEZMVCVMZOC-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |